C22H19Cl2N3O5S2 — CID 2208967
methyl 2-[[[5-[(2,4-dichlorophenoxy)methyl]furan-2-carbonyl]amino]carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 2208967) has the molecular formula C22H19Cl2N3O5S2 and a molecular weight of 540.45 g/mol. Its IUPAC name is methyl 2-[[[5-[(2,4-dichlorophenoxy)methyl]furan-2-carbonyl]amino]carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[[5-[(2,4-dichlorophenoxy)methyl]furan-2-carbonyl]amino]carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2208967 |
| Molecular Formula | C22H19Cl2N3O5S2 |
| Molecular Weight | 540.45 g/mol |
| Exact Mass | 539.01 |
| IUPAC Name | methyl 2-[[[5-[(2,4-dichlorophenoxy)methyl]furan-2-carbonyl]amino]carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NNC(=O)c2ccc(COc3ccc(Cl)cc3Cl)o2)sc2c1CCC2 |
| InChI | InChI=1S/C22H19Cl2N3O5S2/c1-30-21(29)18-13-3-2-4-17(13)34-20(18)25-22(33)27-26-19(28)16-8-6-12(32-16)10-31-15-7-5-11(23)9-14(15)24/h5-9H,2-4,10H2,1H3,(H,26,28)(H2,25,27,33) |
| InChIKey | XHLVMINBUHSDOK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|