C22H32O5 — CID 22090253
1-O-(1-adamantyl) 4-O-(3-oxocyclohexyl) 2,3-dimethylbutanedioate (PubChem CID 22090253) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 1-O-(1-adamantyl) 4-O-(3-oxocyclohexyl) 2,3-dimethylbutanedioate.
| Compound Name | 1-O-(1-adamantyl) 4-O-(3-oxocyclohexyl) 2,3-dimethylbutanedioate |
|---|---|
| PubChem CID | 22090253 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-O-(1-adamantyl) 4-O-(3-oxocyclohexyl) 2,3-dimethylbutanedioate |
| SMILES | CC(C(=O)OC1CCCC(=O)C1)C(C)C(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H32O5/c1-13(20(24)26-19-5-3-4-18(23)9-19)14(2)21(25)27-22-10-15-6-16(11-22)8-17(7-15)12-22/h13-17,19H,3-12H2,1-2H3 |
| InChIKey | RFYNYXIKRCLESQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |