C23H34O5 — CID 22090294
4-O-(1-adamantyl) 1-O-(3-oxocyclohexyl) 2-ethyl-2-methylbutanedioate (PubChem CID 22090294) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is 4-O-(1-adamantyl) 1-O-(3-oxocyclohexyl) 2-ethyl-2-methylbutanedioate.
| Compound Name | 4-O-(1-adamantyl) 1-O-(3-oxocyclohexyl) 2-ethyl-2-methylbutanedioate |
|---|---|
| PubChem CID | 22090294 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 4-O-(1-adamantyl) 1-O-(3-oxocyclohexyl) 2-ethyl-2-methylbutanedioate |
| SMILES | CCC(C)(CC(=O)OC12CC3CC(CC(C3)C1)C2)C(=O)OC1CCCC(=O)C1 |
| InChI | InChI=1S/C23H34O5/c1-3-22(2,21(26)27-19-6-4-5-18(24)10-19)14-20(25)28-23-11-15-7-16(12-23)9-17(8-15)13-23/h15-17,19H,3-14H2,1-2H3 |
| InChIKey | YVTXGVYMANNWCG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |