C16H26N2O2Si — CID 22091467
[3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]imidazo[1,2-a]pyridin-2-yl]methanol (PubChem CID 22091467) has the molecular formula C16H26N2O2Si and a molecular weight of 306.48 g/mol. Its IUPAC name is [3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]imidazo[1,2-a]pyridin-2-yl]methanol.
| Compound Name | [3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]imidazo[1,2-a]pyridin-2-yl]methanol |
|---|---|
| PubChem CID | 22091467 |
| Molecular Formula | C16H26N2O2Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | [3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]imidazo[1,2-a]pyridin-2-yl]methanol |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)c1c(CO)nc2ccccn12 |
| InChI | InChI=1S/C16H26N2O2Si/c1-12(20-21(5,6)16(2,3)4)15-13(11-19)17-14-9-7-8-10-18(14)15/h7-10,12,19H,11H2,1-6H3 |
| InChIKey | VLZCLAUDRXRVGR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|