C22H21NO5S2 — CID 22092091
3-(benzenesulfonyl)-4-(3-pyridin-3-ylpropoxy)-2,3-dihydro-1-benzothiophene 1,1-dioxide (PubChem CID 22092091) has the molecular formula C22H21NO5S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-4-(3-pyridin-3-ylpropoxy)-2,3-dihydro-1-benzothiophene 1,1-dioxide.
| Compound Name | 3-(benzenesulfonyl)-4-(3-pyridin-3-ylpropoxy)-2,3-dihydro-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 22092091 |
| Molecular Formula | C22H21NO5S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 3-(benzenesulfonyl)-4-(3-pyridin-3-ylpropoxy)-2,3-dihydro-1-benzothiophene 1,1-dioxide |
| SMILES | O=S1(=O)CC(S(=O)(=O)c2ccccc2)c2c(OCCCc3cccnc3)cccc21 |
| InChI | InChI=1S/C22H21NO5S2/c24-29(25)16-21(30(26,27)18-9-2-1-3-10-18)22-19(11-4-12-20(22)29)28-14-6-8-17-7-5-13-23-15-17/h1-5,7,9-13,15,21H,6,8,14,16H2 |
| InChIKey | BHJYTVSIDIYPSO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|