C18H20O7S2 — CID 22091955
2-[2-[[3-(benzenesulfonyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-4-yl]oxy]ethoxy]ethanol (PubChem CID 22091955) has the molecular formula C18H20O7S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-[2-[[3-(benzenesulfonyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-4-yl]oxy]ethoxy]ethanol.
| Compound Name | 2-[2-[[3-(benzenesulfonyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-4-yl]oxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 22091955 |
| Molecular Formula | C18H20O7S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2-[2-[[3-(benzenesulfonyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-4-yl]oxy]ethoxy]ethanol |
| SMILES | O=S1(=O)CC(S(=O)(=O)c2ccccc2)c2c(OCCOCCO)cccc21 |
| InChI | InChI=1S/C18H20O7S2/c19-9-10-24-11-12-25-15-7-4-8-16-18(15)17(13-26(16,20)21)27(22,23)14-5-2-1-3-6-14/h1-8,17,19H,9-13H2 |
| InChIKey | FKKSPNXRXPQVIF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|