C19H22O5S2 — CID 22092161
3-(benzenesulfonyl)-5-pentoxy-2,3-dihydro-1-benzothiophene 1,1-dioxide (PubChem CID 22092161) has the molecular formula C19H22O5S2 and a molecular weight of 394.51 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-5-pentoxy-2,3-dihydro-1-benzothiophene 1,1-dioxide.
| Compound Name | 3-(benzenesulfonyl)-5-pentoxy-2,3-dihydro-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 22092161 |
| Molecular Formula | C19H22O5S2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 3-(benzenesulfonyl)-5-pentoxy-2,3-dihydro-1-benzothiophene 1,1-dioxide |
| SMILES | CCCCCOc1ccc2c(c1)C(S(=O)(=O)c1ccccc1)CS2(=O)=O |
| InChI | InChI=1S/C19H22O5S2/c1-2-3-7-12-24-15-10-11-18-17(13-15)19(14-25(18,20)21)26(22,23)16-8-5-4-6-9-16/h4-6,8-11,13,19H,2-3,7,12,14H2,1H3 |
| InChIKey | BKLNADKNZGRJMF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|