C31H35ClN2O6S2 — CID 22092127
[3-(benzenesulfonyl)-4-hexoxy-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl]-[4-(2-chlorophenyl)piperazin-1-yl]methanone (PubChem CID 22092127) has the molecular formula C31H35ClN2O6S2 and a molecular weight of 631.22 g/mol. Its IUPAC name is [3-(benzenesulfonyl)-4-hexoxy-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl]-[4-(2-chlorophenyl)piperazin-1-yl]methanone.
| Compound Name | [3-(benzenesulfonyl)-4-hexoxy-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl]-[4-(2-chlorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 22092127 |
| Molecular Formula | C31H35ClN2O6S2 |
| Molecular Weight | 631.22 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | [3-(benzenesulfonyl)-4-hexoxy-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl]-[4-(2-chlorophenyl)piperazin-1-yl]methanone |
| SMILES | CCCCCCOc1c(C(=O)N2CCN(c3ccccc3Cl)CC2)ccc2c1C(S(=O)(=O)c1ccccc1)CS2(=O)=O |
| InChI | InChI=1S/C31H35ClN2O6S2/c1-2-3-4-10-21-40-30-24(31(35)34-19-17-33(18-20-34)26-14-9-8-13-25(26)32)15-16-27-29(30)28(22-41(27,36)37)42(38,39)23-11-6-5-7-12-23/h5-9,11-16,28H,2-4,10,17-22H2,1H3 |
| InChIKey | JLYOFPBLUHKBHH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.22 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|