C24H32O7S2 — CID 70000508
methyl 3-(benzenesulfonyl)-1,1-dihydroxy-4-octoxy-2,3-dihydro-1-benzothiophene-5-carboxylate (PubChem CID 70000508) has the molecular formula C24H32O7S2 and a molecular weight of 496.65 g/mol. Its IUPAC name is methyl 3-(benzenesulfonyl)-1,1-dihydroxy-4-octoxy-2,3-dihydro-1-benzothiophene-5-carboxylate.
| Compound Name | methyl 3-(benzenesulfonyl)-1,1-dihydroxy-4-octoxy-2,3-dihydro-1-benzothiophene-5-carboxylate |
|---|---|
| PubChem CID | 70000508 |
| Molecular Formula | C24H32O7S2 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | methyl 3-(benzenesulfonyl)-1,1-dihydroxy-4-octoxy-2,3-dihydro-1-benzothiophene-5-carboxylate |
| SMILES | CCCCCCCCOc1c(C(=O)OC)ccc2c1C(S(=O)(=O)c1ccccc1)CS2(O)O |
| InChI | InChI=1S/C24H32O7S2/c1-3-4-5-6-7-11-16-31-23-19(24(25)30-2)14-15-20-22(23)21(17-32(20,26)27)33(28,29)18-12-9-8-10-13-18/h8-10,12-15,21,26-27H,3-7,11,16-17H2,1-2H3 |
| InChIKey | HNQDBMGBCJLFTN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|