C19H22O3S2 — CID 22092366
6-pentoxy-3-phenylsulfanyl-2,3-dihydro-1-benzothiophene 1,1-dioxide (PubChem CID 22092366) has the molecular formula C19H22O3S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is 6-pentoxy-3-phenylsulfanyl-2,3-dihydro-1-benzothiophene 1,1-dioxide.
| Compound Name | 6-pentoxy-3-phenylsulfanyl-2,3-dihydro-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 22092366 |
| Molecular Formula | C19H22O3S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 6-pentoxy-3-phenylsulfanyl-2,3-dihydro-1-benzothiophene 1,1-dioxide |
| SMILES | CCCCCOc1ccc2c(c1)S(=O)(=O)CC2Sc1ccccc1 |
| InChI | InChI=1S/C19H22O3S2/c1-2-3-7-12-22-15-10-11-17-18(14-24(20,21)19(17)13-15)23-16-8-5-4-6-9-16/h4-6,8-11,13,18H,2-3,7,12,14H2,1H3 |
| InChIKey | LIJJNIASHNTEJP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|