C16H17ClN2O7S2 — CID 70008615
2-[[3-(benzenesulfonyl)-4-nitro-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl]oxy]ethanamine;hydrochloride (PubChem CID 70008615) has the molecular formula C16H17ClN2O7S2 and a molecular weight of 448.91 g/mol. Its IUPAC name is 2-[[3-(benzenesulfonyl)-4-nitro-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl]oxy]ethanamine;hydrochloride.
| Compound Name | 2-[[3-(benzenesulfonyl)-4-nitro-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl]oxy]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 70008615 |
| Molecular Formula | C16H17ClN2O7S2 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | 2-[[3-(benzenesulfonyl)-4-nitro-1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl]oxy]ethanamine;hydrochloride |
| SMILES | Cl.NCCOc1ccc2c(c1[N+](=O)[O-])C(S(=O)(=O)c1ccccc1)CS2(=O)=O |
| InChI | InChI=1S/C16H16N2O7S2.ClH/c17-8-9-25-12-6-7-13-15(16(12)18(19)20)14(10-26(13,21)22)27(23,24)11-4-2-1-3-5-11;/h1-7,14H,8-10,17H2;1H |
| InChIKey | QZOGMHLYZRFINJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 146.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|