C13H15NO3S — CID 22092322
4-(morpholin-4-ylmethyl)-1-benzothiophene 1,1-dioxide (PubChem CID 22092322) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is 4-(morpholin-4-ylmethyl)-1-benzothiophene 1,1-dioxide.
| Compound Name | 4-(morpholin-4-ylmethyl)-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 22092322 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 4-(morpholin-4-ylmethyl)-1-benzothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C=Cc2c(CN3CCOCC3)cccc21 |
| InChI | InChI=1S/C13H15NO3S/c15-18(16)9-4-12-11(2-1-3-13(12)18)10-14-5-7-17-8-6-14/h1-4,9H,5-8,10H2 |
| InChIKey | SJUUKVMKVHCMBJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |