C13H15NO4S — CID 117172542
2-(morpholin-4-ylmethyl)-1,1-dioxo-1-benzothiophen-4-ol (PubChem CID 117172542) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 2-(morpholin-4-ylmethyl)-1,1-dioxo-1-benzothiophen-4-ol.
| Compound Name | 2-(morpholin-4-ylmethyl)-1,1-dioxo-1-benzothiophen-4-ol |
|---|---|
| PubChem CID | 117172542 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-(morpholin-4-ylmethyl)-1,1-dioxo-1-benzothiophen-4-ol |
| SMILES | O=S1(=O)C(CN2CCOCC2)=Cc2c(O)cccc21 |
| InChI | InChI=1S/C13H15NO4S/c15-12-2-1-3-13-11(12)8-10(19(13,16)17)9-14-4-6-18-7-5-14/h1-3,8,15H,4-7,9H2 |
| InChIKey | PYZSJQYJRNQVNZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |