C26H26N4O4S — CID 22092972
ethyl 3-[[3-[3-(1H-imidazol-2-ylamino)phenyl]phenyl]sulfonylamino]-3-phenylpropanoate (PubChem CID 22092972) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is ethyl 3-[[3-[3-(1H-imidazol-2-ylamino)phenyl]phenyl]sulfonylamino]-3-phenylpropanoate.
| Compound Name | ethyl 3-[[3-[3-(1H-imidazol-2-ylamino)phenyl]phenyl]sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 22092972 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | ethyl 3-[[3-[3-(1H-imidazol-2-ylamino)phenyl]phenyl]sulfonylamino]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(NS(=O)(=O)c1cccc(-c2cccc(Nc3ncc[nH]3)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C26H26N4O4S/c1-2-34-25(31)18-24(19-8-4-3-5-9-19)30-35(32,33)23-13-7-11-21(17-23)20-10-6-12-22(16-20)29-26-27-14-15-28-26/h3-17,24,30H,2,18H2,1H3,(H2,27,28,29) |
| InChIKey | CQHQNPLSQRUCHJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |