C17H20N2O4S — CID 22095969
1-(2-butylsulfanylethyl)-3-[(2Z)-2-(hydroxymethylidene)-1,3-dioxoinden-5-yl]urea (PubChem CID 22095969) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 1-(2-butylsulfanylethyl)-3-[(2Z)-2-(hydroxymethylidene)-1,3-dioxoinden-5-yl]urea.
| Compound Name | 1-(2-butylsulfanylethyl)-3-[(2Z)-2-(hydroxymethylidene)-1,3-dioxoinden-5-yl]urea |
|---|---|
| PubChem CID | 22095969 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-(2-butylsulfanylethyl)-3-[(2Z)-2-(hydroxymethylidene)-1,3-dioxoinden-5-yl]urea |
| SMILES | CCCCSCCNC(=O)Nc1ccc2c(c1)C(=O)/C(=C\O)C2=O |
| InChI | InChI=1S/C17H20N2O4S/c1-2-3-7-24-8-6-18-17(23)19-11-4-5-12-13(9-11)16(22)14(10-20)15(12)21/h4-5,9-10,20H,2-3,6-8H2,1H3,(H2,18,19,23)/b14-10- |
| InChIKey | BFPXBEVUEPDTOH-UVTDQMKNSA-N |
| XLogP | 3.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|