C20H21N3O2 — CID 22095973
1,2-dibenzyl-4-(dimethylaminomethylidene)pyrazolidine-3,5-dione (PubChem CID 22095973) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1,2-dibenzyl-4-(dimethylaminomethylidene)pyrazolidine-3,5-dione.
| Compound Name | 1,2-dibenzyl-4-(dimethylaminomethylidene)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 22095973 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1,2-dibenzyl-4-(dimethylaminomethylidene)pyrazolidine-3,5-dione |
| SMILES | CN(C)C=C1C(=O)N(Cc2ccccc2)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C20H21N3O2/c1-21(2)15-18-19(24)22(13-16-9-5-3-6-10-16)23(20(18)25)14-17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3 |
| InChIKey | FRDRODOTVFMCGM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|