C18H15KN2O3 — CID 20713346
potassium (1,2-dibenzyl-3,5-dioxopyrazolidin-4-ylidene)methanolate (PubChem CID 20713346) has the molecular formula C18H15KN2O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is potassium (1,2-dibenzyl-3,5-dioxopyrazolidin-4-ylidene)methanolate.
| Compound Name | potassium (1,2-dibenzyl-3,5-dioxopyrazolidin-4-ylidene)methanolate |
|---|---|
| PubChem CID | 20713346 |
| Molecular Formula | C18H15KN2O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | potassium (1,2-dibenzyl-3,5-dioxopyrazolidin-4-ylidene)methanolate |
| SMILES | O=C1C(=C[O-])C(=O)N(Cc2ccccc2)N1Cc1ccccc1.[K+] |
| InChI | InChI=1S/C18H16N2O3.K/c21-13-16-17(22)19(11-14-7-3-1-4-8-14)20(18(16)23)12-15-9-5-2-6-10-15;/h1-10,13,21H,11-12H2;/q;+1/p-1 |
| InChIKey | BEGAPSSBDXCXJV-UHFFFAOYSA-M |
| XLogP | -1.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|