C20H16N2O2 — CID 12958495
2,5-dibenzylpyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 12958495) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2,5-dibenzylpyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | 2,5-dibenzylpyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 12958495 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2,5-dibenzylpyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | O=C1c2cn(Cc3ccccc3)cc2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H16N2O2/c23-19-17-13-21(11-15-7-3-1-4-8-15)14-18(17)20(24)22(19)12-16-9-5-2-6-10-16/h1-10,13-14H,11-12H2 |
| InChIKey | YHCFXJICOHZABL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|