C12H8NNaO4 — CID 132577433
sodium 1-benzyl-4-formyl-2,5-dioxopyrrol-3-olate (PubChem CID 132577433) has the molecular formula C12H8NNaO4 and a molecular weight of 253.19 g/mol. Its IUPAC name is sodium 1-benzyl-4-formyl-2,5-dioxopyrrol-3-olate.
| Compound Name | sodium 1-benzyl-4-formyl-2,5-dioxopyrrol-3-olate |
|---|---|
| PubChem CID | 132577433 |
| Molecular Formula | C12H8NNaO4 |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | sodium 1-benzyl-4-formyl-2,5-dioxopyrrol-3-olate |
| SMILES | O=CC1=C([O-])C(=O)N(Cc2ccccc2)C1=O.[Na+] |
| InChI | InChI=1S/C12H9NO4.Na/c14-7-9-10(15)12(17)13(11(9)16)6-8-4-2-1-3-5-8;/h1-5,7,15H,6H2;/q;+1/p-1 |
| InChIKey | LMQDFCMYMWMDHW-UHFFFAOYSA-M |
| XLogP | -3.63 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|