C10H7NO3 — CID 22096039
5-oxo-3-phenyl-2H-1,2-oxazole-4-carbaldehyde (PubChem CID 22096039) has the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. Its IUPAC name is 5-oxo-3-phenyl-2H-1,2-oxazole-4-carbaldehyde.
| Compound Name | 5-oxo-3-phenyl-2H-1,2-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 22096039 |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 5-oxo-3-phenyl-2H-1,2-oxazole-4-carbaldehyde |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)ON2)C=O |
| InChI | InChI=1S/C10H7NO3/c12-6-8-9(11-14-10(8)13)7-4-2-1-3-5-7/h1-6,11H |
| InChIKey | LDCRRMUUIZEEDF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 290 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|