C20H25Cl2NO2 — CID 22102480
3-(cyclohexylmethyl)-5-(3,4-dichlorophenyl)-5-prop-2-enyl-1,3-oxazinan-2-one (PubChem CID 22102480) has the molecular formula C20H25Cl2NO2 and a molecular weight of 382.33 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-5-(3,4-dichlorophenyl)-5-prop-2-enyl-1,3-oxazinan-2-one.
| Compound Name | 3-(cyclohexylmethyl)-5-(3,4-dichlorophenyl)-5-prop-2-enyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 22102480 |
| Molecular Formula | C20H25Cl2NO2 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3-(cyclohexylmethyl)-5-(3,4-dichlorophenyl)-5-prop-2-enyl-1,3-oxazinan-2-one |
| SMILES | C=CCC1(c2ccc(Cl)c(Cl)c2)COC(=O)N(CC2CCCCC2)C1 |
| InChI | InChI=1S/C20H25Cl2NO2/c1-2-10-20(16-8-9-17(21)18(22)11-16)13-23(19(24)25-14-20)12-15-6-4-3-5-7-15/h2,8-9,11,15H,1,3-7,10,12-14H2 |
| InChIKey | YTDBSSWZYMCYPH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|