C15H19Cl2NO — CID 58954910
4a-(3,4-dichlorophenyl)-3-methyl-4,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 58954910) has the molecular formula C15H19Cl2NO and a molecular weight of 300.23 g/mol. Its IUPAC name is 4a-(3,4-dichlorophenyl)-3-methyl-4,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | 4a-(3,4-dichlorophenyl)-3-methyl-4,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 58954910 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4a-(3,4-dichlorophenyl)-3-methyl-4,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | CN1COC2CCCCC2(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H19Cl2NO/c1-18-9-15(7-3-2-4-14(15)19-10-18)11-5-6-12(16)13(17)8-11/h5-6,8,14H,2-4,7,9-10H2,1H3 |
| InChIKey | WUZCGLBJMGGJMO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |