C15H20Cl3NO — CID 16719457
(1R,2S,9aR)-1-(3,4-dichlorophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-ol;hydrochloride (PubChem CID 16719457) has the molecular formula C15H20Cl3NO and a molecular weight of 336.69 g/mol. Its IUPAC name is (1R,2S,9aR)-1-(3,4-dichlorophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-ol;hydrochloride.
| Compound Name | (1R,2S,9aR)-1-(3,4-dichlorophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-ol;hydrochloride |
|---|---|
| PubChem CID | 16719457 |
| Molecular Formula | C15H20Cl3NO |
| Molecular Weight | 336.69 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | (1R,2S,9aR)-1-(3,4-dichlorophenyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-ol;hydrochloride |
| SMILES | Cl.O[C@H]1CCN2CCCC[C@@H]2[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2NO.ClH/c16-11-5-4-10(9-12(11)17)15-13-3-1-2-7-18(13)8-6-14(15)19;/h4-5,9,13-15,19H,1-3,6-8H2;1H/t13-,14+,15-;/m1./s1 |
| InChIKey | URABJMZZEPRJEN-USAYTKQKSA-N |
| XLogP | 4.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.69 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |