C15H18N4OS2 — CID 22110936
N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide (PubChem CID 22110936) has the molecular formula C15H18N4OS2 and a molecular weight of 334.47 g/mol. Its IUPAC name is N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide.
| Compound Name | N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 22110936 |
| Molecular Formula | C15H18N4OS2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
| SMILES | Cc1cc(NC(=O)CSc2nncs2)ccc1N1CCCC1 |
| InChI | InChI=1S/C15H18N4OS2/c1-11-8-12(4-5-13(11)19-6-2-3-7-19)17-14(20)9-21-15-18-16-10-22-15/h4-5,8,10H,2-3,6-7,9H2,1H3,(H,17,20) |
| InChIKey | CRNMRJTZVYTQHR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|