C20H22F2N3S+ — CID 2211175
N-(2,4-difluorophenyl)-4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-carbothioamide (PubChem CID 2211175) has the molecular formula C20H22F2N3S+ and a molecular weight of 374.48 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(2,4-difluorophenyl)-4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 2211175 |
| Molecular Formula | C20H22F2N3S+ |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-[(E)-3-phenylprop-2-enyl]piperazin-4-ium-1-carbothioamide |
| SMILES | Fc1ccc(NC(=S)N2CC[NH+](C/C=C/c3ccccc3)CC2)c(F)c1 |
| InChI | InChI=1S/C20H21F2N3S/c21-17-8-9-19(18(22)15-17)23-20(26)25-13-11-24(12-14-25)10-4-7-16-5-2-1-3-6-16/h1-9,15H,10-14H2,(H,23,26)/p+1/b7-4+ |
| InChIKey | LGFYBWSZKHBLEG-QPJJXVBHSA-O |
| XLogP | 2.58 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|