About N-dodecyldodecan-1-amine oxide
N-dodecyldodecan-1-amine oxide (PubChem CID 22112105) has the molecular formula C24H51NO
and a molecular weight of 369.68 g/mol. Its IUPAC name is N-dodecyldodecan-1-amine oxide.
Molecular Properties
| Compound Name | N-dodecyldodecan-1-amine oxide |
| PubChem CID | 22112105 |
| Molecular Formula | C24H51NO |
| Molecular Weight | 369.68 g/mol |
| Exact Mass | 369.40 |
| IUPAC Name | N-dodecyldodecan-1-amine oxide |
| SMILES | CCCCCCCCCCCC[NH+]([O-])CCCCCCCCCCCC |
| InChI | InChI=1S/C24H51NO/c1-3-5-7-9-11-13-15-17-19-21-23-25(26)24-22-20-18-16-14-12-10-8-6-4-2/h25H,3-24H2,1-2H3 |
| InChIKey | ZNGVPZXFRBRHSD-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 27.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.68 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-dodecyldodecan-1-amine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-dodecyldodecan-1-amine oxide?
The IUPAC name of N-dodecyldodecan-1-amine oxide (CID 22112105) is N-dodecyldodecan-1-amine oxide.
What is the SMILES notation for N-dodecyldodecan-1-amine oxide?
The canonical SMILES for N-dodecyldodecan-1-amine oxide is CCCCCCCCCCCC[NH+]([O-])CCCCCCCCCCCC.
What is the InChIKey of N-dodecyldodecan-1-amine oxide?
The InChIKey is ZNGVPZXFRBRHSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51NO/c1-3-5-7-9-11-13-15-17-19-21-23-25(26)24-22-20-18-16-14-12-10-8-6-4-2/h25H,3-24H2,1-2H3.
What are the key properties of N-dodecyldodecan-1-amine oxide?
N-dodecyldodecan-1-amine oxide has a molecular weight of 369.68 g/mol, XLogP of 7.21, 22 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-dodecyldodecan-1-amine oxide is sourced from PubChem (CID 22112105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).