C11H16O6 — CID 22116752
(3-ethenoxycarbonyloxy-2,2-dimethylpropyl) ethenyl carbonate (PubChem CID 22116752) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is (3-ethenoxycarbonyloxy-2,2-dimethylpropyl) ethenyl carbonate.
| Compound Name | (3-ethenoxycarbonyloxy-2,2-dimethylpropyl) ethenyl carbonate |
|---|---|
| PubChem CID | 22116752 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (3-ethenoxycarbonyloxy-2,2-dimethylpropyl) ethenyl carbonate |
| SMILES | C=COC(=O)OCC(C)(C)COC(=O)OC=C |
| InChI | InChI=1S/C11H16O6/c1-5-14-9(12)16-7-11(3,4)8-17-10(13)15-6-2/h5-6H,1-2,7-8H2,3-4H3 |
| InChIKey | QMBPDUIWDIDECJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|