C14H12F3N3S2 — CID 22116921
4-(4,4-dimethyl-2-methylsulfanyl-5-sulfanylideneimidazol-1-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 22116921) has the molecular formula C14H12F3N3S2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 4-(4,4-dimethyl-2-methylsulfanyl-5-sulfanylideneimidazol-1-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(4,4-dimethyl-2-methylsulfanyl-5-sulfanylideneimidazol-1-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22116921 |
| Molecular Formula | C14H12F3N3S2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 4-(4,4-dimethyl-2-methylsulfanyl-5-sulfanylideneimidazol-1-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | CSC1=NC(C)(C)C(=S)N1c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F3N3S2/c1-13(2)11(21)20(12(19-13)22-3)9-5-4-8(7-18)10(6-9)14(15,16)17/h4-6H,1-3H3 |
| InChIKey | REJCVDSBNPPOQG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|