C38H76N2S4Zn — CID 22117744
zinc bis(N,N-bis(7-methyloctyl)carbamodithioate) (PubChem CID 22117744) has the molecular formula C38H76N2S4Zn and a molecular weight of 754.70 g/mol. Its IUPAC name is zinc bis(N,N-bis(7-methyloctyl)carbamodithioate).
| Compound Name | zinc bis(N,N-bis(7-methyloctyl)carbamodithioate) |
|---|---|
| PubChem CID | 22117744 |
| Molecular Formula | C38H76N2S4Zn |
| Molecular Weight | 754.70 g/mol |
| Exact Mass | 752.42 |
| IUPAC Name | zinc bis(N,N-bis(7-methyloctyl)carbamodithioate) |
| SMILES | CC(C)CCCCCCN(CCCCCCC(C)C)C(=S)[S-].CC(C)CCCCCCN(CCCCCCC(C)C)C(=S)[S-].[Zn+2] |
| InChI | InChI=1S/2C19H39NS2.Zn/c2*1-17(2)13-9-5-7-11-15-20(19(21)22)16-12-8-6-10-14-18(3)4;/h2*17-18H,5-16H2,1-4H3,(H,21,22);/q;;+2/p-2 |
| InChIKey | DRKOTOCDZAUOFY-UHFFFAOYSA-L |
| XLogP | 12.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.70 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|