C28H31NO5 — CID 22118319
benzyl 1-[2-methyl-2-(6-methyl-4-oxo-5-phenyl-2H-1,3-oxazin-3-yl)propanoyl]cyclopentane-1-carboxylate (PubChem CID 22118319) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is benzyl 1-[2-methyl-2-(6-methyl-4-oxo-5-phenyl-2H-1,3-oxazin-3-yl)propanoyl]cyclopentane-1-carboxylate.
| Compound Name | benzyl 1-[2-methyl-2-(6-methyl-4-oxo-5-phenyl-2H-1,3-oxazin-3-yl)propanoyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 22118319 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | benzyl 1-[2-methyl-2-(6-methyl-4-oxo-5-phenyl-2H-1,3-oxazin-3-yl)propanoyl]cyclopentane-1-carboxylate |
| SMILES | CC1=C(c2ccccc2)C(=O)N(C(C)(C)C(=O)C2(C(=O)OCc3ccccc3)CCCC2)CO1 |
| InChI | InChI=1S/C28H31NO5/c1-20-23(22-14-8-5-9-15-22)24(30)29(19-34-20)27(2,3)25(31)28(16-10-11-17-28)26(32)33-18-21-12-6-4-7-13-21/h4-9,12-15H,10-11,16-19H2,1-3H3 |
| InChIKey | LMLHKENNNSWSCD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|