C14H30O2Si — CID 22121314
1-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhex-5-en-3-ol (PubChem CID 22121314) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhex-5-en-3-ol.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhex-5-en-3-ol |
|---|---|
| PubChem CID | 22121314 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylhex-5-en-3-ol |
| SMILES | C=CC(C)(C)C(O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O2Si/c1-9-14(5,6)12(15)10-11-16-17(7,8)13(2,3)4/h9,12,15H,1,10-11H2,2-8H3 |
| InChIKey | NERDIUMEHSWCKX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|