C33H33N7O5 — CID 22122517
3-morpholin-4-ylpropyl (E)-4-oxo-4-[[4-[(2-phenylmethoxy-1H-indol-5-yl)amino]pyrido[3,4-d]pyrimidin-6-yl]amino]but-2-enoate (PubChem CID 22122517) has the molecular formula C33H33N7O5 and a molecular weight of 607.67 g/mol. Its IUPAC name is 3-morpholin-4-ylpropyl (E)-4-oxo-4-[[4-[(2-phenylmethoxy-1H-indol-5-yl)amino]pyrido[3,4-d]pyrimidin-6-yl]amino]but-2-enoate.
| Compound Name | 3-morpholin-4-ylpropyl (E)-4-oxo-4-[[4-[(2-phenylmethoxy-1H-indol-5-yl)amino]pyrido[3,4-d]pyrimidin-6-yl]amino]but-2-enoate |
|---|---|
| PubChem CID | 22122517 |
| Molecular Formula | C33H33N7O5 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | 3-morpholin-4-ylpropyl (E)-4-oxo-4-[[4-[(2-phenylmethoxy-1H-indol-5-yl)amino]pyrido[3,4-d]pyrimidin-6-yl]amino]but-2-enoate |
| SMILES | O=C(/C=C/C(=O)OCCCN1CCOCC1)Nc1cc2c(Nc3ccc4[nH]c(OCc5ccccc5)cc4c3)ncnc2cn1 |
| InChI | InChI=1S/C33H33N7O5/c41-30(9-10-32(42)44-14-4-11-40-12-15-43-16-13-40)39-29-19-26-28(20-34-29)35-22-36-33(26)37-25-7-8-27-24(17-25)18-31(38-27)45-21-23-5-2-1-3-6-23/h1-3,5-10,17-20,22,38H,4,11-16,21H2,(H,34,39,41)(H,35,36,37)/b10-9+ |
| InChIKey | FFKIITXEOILDQB-MDZDMXLPSA-N |
| XLogP | 4.59 |
| TPSA | 143.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|