About 3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one
3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one (PubChem CID 22122698) has the molecular formula C17H15N3O6
and a molecular weight of 357.32 g/mol. Its IUPAC name is 3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one.
Molecular Properties
| Compound Name | 3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one |
| PubChem CID | 22122698 |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one |
| SMILES | CC1=C(n2cccc([N+](=O)[O-])c2=O)c2cc([N+](=O)[O-])ccc2OC1(C)C |
| InChI | InChI=1S/C17H15N3O6/c1-10-15(18-8-4-5-13(16(18)21)20(24)25)12-9-11(19(22)23)6-7-14(12)26-17(10,2)3/h4-9H,1-3H3 |
| InChIKey | HJDUVDSZXOWUFN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 117.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one?
The IUPAC name of 3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one (CID 22122698) is 3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one.
What is the SMILES notation for 3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one?
The canonical SMILES for 3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one is CC1=C(n2cccc([N+](=O)[O-])c2=O)c2cc([N+](=O)[O-])ccc2OC1(C)C.
What is the InChIKey of 3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one?
The InChIKey is HJDUVDSZXOWUFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O6/c1-10-15(18-8-4-5-13(16(18)21)20(24)25)12-9-11(19(22)23)6-7-14(12)26-17(10,2)3/h4-9H,1-3H3.
What are the key properties of 3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one?
3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one has a molecular weight of 357.32 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-1-(2,2,3-trimethyl-6-nitrochromen-4-yl)pyridin-2-one is sourced from PubChem (CID 22122698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).