C22H29NO4 — CID 170611073
ethane;2,2,3-trimethyl-4-(4-nitrophenyl)chromen-7-ol (PubChem CID 170611073) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is ethane;2,2,3-trimethyl-4-(4-nitrophenyl)chromen-7-ol.
| Compound Name | ethane;2,2,3-trimethyl-4-(4-nitrophenyl)chromen-7-ol |
|---|---|
| PubChem CID | 170611073 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | ethane;2,2,3-trimethyl-4-(4-nitrophenyl)chromen-7-ol |
| SMILES | CC.CC.CC1=C(c2ccc([N+](=O)[O-])cc2)c2ccc(O)cc2OC1(C)C |
| InChI | InChI=1S/C18H17NO4.2C2H6/c1-11-17(12-4-6-13(7-5-12)19(21)22)15-9-8-14(20)10-16(15)23-18(11,2)3;2*1-2/h4-10,20H,1-3H3;2*1-2H3 |
| InChIKey | MYSJVVKCHIZDRT-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|