C22H22N2O3S — CID 2212546
1-(2,4-dimethoxyphenyl)-3-(4-phenylmethoxyphenyl)thiourea (PubChem CID 2212546) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-(4-phenylmethoxyphenyl)thiourea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-(4-phenylmethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 2212546 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-(4-phenylmethoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(OCc3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C22H22N2O3S/c1-25-19-12-13-20(21(14-19)26-2)24-22(28)23-17-8-10-18(11-9-17)27-15-16-6-4-3-5-7-16/h3-14H,15H2,1-2H3,(H2,23,24,28) |
| InChIKey | FZSLITOVSXECPA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|