C22H25NO5 — CID 22127935
3-hydroxy-4-[4-[(E)-4-phenoxybut-2-enoxy]phenyl]piperidine-1-carboxylic acid (PubChem CID 22127935) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is 3-hydroxy-4-[4-[(E)-4-phenoxybut-2-enoxy]phenyl]piperidine-1-carboxylic acid.
| Compound Name | 3-hydroxy-4-[4-[(E)-4-phenoxybut-2-enoxy]phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22127935 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 3-hydroxy-4-[4-[(E)-4-phenoxybut-2-enoxy]phenyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2ccc(OC/C=C/COc3ccccc3)cc2)C(O)C1 |
| InChI | InChI=1S/C22H25NO5/c24-21-16-23(22(25)26)13-12-20(21)17-8-10-19(11-9-17)28-15-5-4-14-27-18-6-2-1-3-7-18/h1-11,20-21,24H,12-16H2,(H,25,26)/b5-4+ |
| InChIKey | AQIVPURQWULFDQ-SNAWJCMRSA-N |
| XLogP | 3.53 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|