C22H26NO6- — CID 22127932
3-hydroxy-4-[4-[3-(3-methoxyphenoxy)propoxy]phenyl]piperidine-1-carboxylate (PubChem CID 22127932) has the molecular formula C22H26NO6- and a molecular weight of 400.45 g/mol. Its IUPAC name is 3-hydroxy-4-[4-[3-(3-methoxyphenoxy)propoxy]phenyl]piperidine-1-carboxylate.
| Compound Name | 3-hydroxy-4-[4-[3-(3-methoxyphenoxy)propoxy]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22127932 |
| Molecular Formula | C22H26NO6- |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 3-hydroxy-4-[4-[3-(3-methoxyphenoxy)propoxy]phenyl]piperidine-1-carboxylate |
| SMILES | COc1cccc(OCCCOc2ccc(C3CCN(C(=O)[O-])CC3O)cc2)c1 |
| InChI | InChI=1S/C22H27NO6/c1-27-18-4-2-5-19(14-18)29-13-3-12-28-17-8-6-16(7-9-17)20-10-11-23(22(25)26)15-21(20)24/h2,4-9,14,20-21,24H,3,10-13,15H2,1H3,(H,25,26)/p-1 |
| InChIKey | WFMOJYJPTHMWQV-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|