C19H17FN2 — CID 22131626
2-[2-(4-fluorophenyl)phenyl]-5-propylpyrimidine (PubChem CID 22131626) has the molecular formula C19H17FN2 and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)phenyl]-5-propylpyrimidine.
| Compound Name | 2-[2-(4-fluorophenyl)phenyl]-5-propylpyrimidine |
|---|---|
| PubChem CID | 22131626 |
| Molecular Formula | C19H17FN2 |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-[2-(4-fluorophenyl)phenyl]-5-propylpyrimidine |
| SMILES | CCCc1cnc(-c2ccccc2-c2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C19H17FN2/c1-2-5-14-12-21-19(22-13-14)18-7-4-3-6-17(18)15-8-10-16(20)11-9-15/h3-4,6-13H,2,5H2,1H3 |
| InChIKey | BPJCMGDNXMUJOI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |