C25H32N2O4 — CID 22131784
4,4-dimethyl-2-[4-(2-nitro-4-octan-2-yloxyphenyl)phenyl]-5H-1,3-oxazole (PubChem CID 22131784) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 4,4-dimethyl-2-[4-(2-nitro-4-octan-2-yloxyphenyl)phenyl]-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-[4-(2-nitro-4-octan-2-yloxyphenyl)phenyl]-5H-1,3-oxazole |
|---|---|
| PubChem CID | 22131784 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 4,4-dimethyl-2-[4-(2-nitro-4-octan-2-yloxyphenyl)phenyl]-5H-1,3-oxazole |
| SMILES | CCCCCCC(C)Oc1ccc(-c2ccc(C3=NC(C)(C)CO3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H32N2O4/c1-5-6-7-8-9-18(2)31-21-14-15-22(23(16-21)27(28)29)19-10-12-20(13-11-19)24-26-25(3,4)17-30-24/h10-16,18H,5-9,17H2,1-4H3 |
| InChIKey | HPHHFOPOSPZLBO-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|