About 3-ethenoxypropanoic acid
3-ethenoxypropanoic acid (PubChem CID 22133478) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is 3-ethenoxypropanoic acid.
Molecular Properties
| Compound Name | 3-ethenoxypropanoic acid |
| PubChem CID | 22133478 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | 3-ethenoxypropanoic acid |
| SMILES | C=COCCC(=O)O |
| InChI | InChI=1S/C5H8O3/c1-2-8-4-3-5(6)7/h2H,1,3-4H2,(H,6,7) |
| InChIKey | XUKWFDWKURBTFK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenoxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenoxypropanoic acid?
The IUPAC name of 3-ethenoxypropanoic acid (CID 22133478) is 3-ethenoxypropanoic acid.
What is the SMILES notation for 3-ethenoxypropanoic acid?
The canonical SMILES for 3-ethenoxypropanoic acid is C=COCCC(=O)O.
What is the InChIKey of 3-ethenoxypropanoic acid?
The InChIKey is XUKWFDWKURBTFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3/c1-2-8-4-3-5(6)7/h2H,1,3-4H2,(H,6,7).
What are the key properties of 3-ethenoxypropanoic acid?
3-ethenoxypropanoic acid has a molecular weight of 116.12 g/mol, XLogP of 0.62, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenoxypropanoic acid is sourced from PubChem (CID 22133478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).