3-ethenoxypropanoic acid

C5H8O3 — CID 22133478

IUPAC3-ethenoxypropanoic acid
SMILESC=COCCC(=O)O
InChIInChI=1S/C5H8O3/c1-2-8-4-3-5(6)7/h2H,1,3-4H2,(H,6,7)
InChIKeyXUKWFDWKURBTFK-UHFFFAOYSA-N
MW116.12 g/mol
LogP0.62
Rot. Bonds4

About 3-ethenoxypropanoic acid

3-ethenoxypropanoic acid (PubChem CID 22133478) has the molecular formula C5H8O3 and a molecular weight of 116.12 g/mol. Its IUPAC name is 3-ethenoxypropanoic acid.

Molecular Properties

Compound Name3-ethenoxypropanoic acid
PubChem CID22133478
Molecular FormulaC5H8O3
Molecular Weight116.12 g/mol
Exact Mass116.05
IUPAC Name3-ethenoxypropanoic acid
SMILESC=COCCC(=O)O
InChIInChI=1S/C5H8O3/c1-2-8-4-3-5(6)7/h2H,1,3-4H2,(H,6,7)
InChIKeyXUKWFDWKURBTFK-UHFFFAOYSA-N
XLogP0.62
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500116.12
LogP ≤ 50.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-ethenoxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethenoxypropanoic acid?
The IUPAC name of 3-ethenoxypropanoic acid (CID 22133478) is 3-ethenoxypropanoic acid.
What is the SMILES notation for 3-ethenoxypropanoic acid?
The canonical SMILES for 3-ethenoxypropanoic acid is C=COCCC(=O)O.
What is the InChIKey of 3-ethenoxypropanoic acid?
The InChIKey is XUKWFDWKURBTFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3/c1-2-8-4-3-5(6)7/h2H,1,3-4H2,(H,6,7).
What are the key properties of 3-ethenoxypropanoic acid?
3-ethenoxypropanoic acid has a molecular weight of 116.12 g/mol, XLogP of 0.62, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenoxypropanoic acid is sourced from PubChem (CID 22133478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).