C28H39F2N5O3 — CID 22135810
1-butyl-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-(1-hydroxy-2-methylpropyl)-1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 22135810) has the molecular formula C28H39F2N5O3 and a molecular weight of 531.65 g/mol. Its IUPAC name is 1-butyl-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-(1-hydroxy-2-methylpropyl)-1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | 1-butyl-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-(1-hydroxy-2-methylpropyl)-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 22135810 |
| Molecular Formula | C28H39F2N5O3 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | 1-butyl-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-(1-hydroxy-2-methylpropyl)-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | CCCCN1C(=O)C(C(O)C(C)C)NC(=O)C12CCN(Cc1c(C)nn(-c3ccc(F)cc3F)c1C)CC2 |
| InChI | InChI=1S/C28H39F2N5O3/c1-6-7-12-34-26(37)24(25(36)17(2)3)31-27(38)28(34)10-13-33(14-11-28)16-21-18(4)32-35(19(21)5)23-9-8-20(29)15-22(23)30/h8-9,15,17,24-25,36H,6-7,10-14,16H2,1-5H3,(H,31,38) |
| InChIKey | JGHMVDPNTYPNDR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |