C28H33ClN4O3S — CID 22139545
N-[2-[3-(4-chlorophenyl)propylamino]cyclopentyl]-2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 22139545) has the molecular formula C28H33ClN4O3S and a molecular weight of 541.12 g/mol. Its IUPAC name is N-[2-[3-(4-chlorophenyl)propylamino]cyclopentyl]-2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-[2-[3-(4-chlorophenyl)propylamino]cyclopentyl]-2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 22139545 |
| Molecular Formula | C28H33ClN4O3S |
| Molecular Weight | 541.12 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | N-[2-[3-(4-chlorophenyl)propylamino]cyclopentyl]-2-[5-(3,4-dimethoxyphenyl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | COc1ccc(-c2cnc(SCC(=O)NC3CCCC3NCCCc3ccc(Cl)cc3)nc2)cc1OC |
| InChI | InChI=1S/C28H33ClN4O3S/c1-35-25-13-10-20(15-26(25)36-2)21-16-31-28(32-17-21)37-18-27(34)33-24-7-3-6-23(24)30-14-4-5-19-8-11-22(29)12-9-19/h8-13,15-17,23-24,30H,3-7,14,18H2,1-2H3,(H,33,34) |
| InChIKey | MVNVFSUUUZEKTG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.12 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|