C23H29ClN2O4 — CID 23574660
N-[2-[2-(4-chlorophenyl)ethylamino]cyclopentyl]-3,4,5-trimethoxybenzamide (PubChem CID 23574660) has the molecular formula C23H29ClN2O4 and a molecular weight of 432.95 g/mol. Its IUPAC name is N-[2-[2-(4-chlorophenyl)ethylamino]cyclopentyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[2-(4-chlorophenyl)ethylamino]cyclopentyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 23574660 |
| Molecular Formula | C23H29ClN2O4 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-[2-[2-(4-chlorophenyl)ethylamino]cyclopentyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC2CCCC2NCCc2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H29ClN2O4/c1-28-20-13-16(14-21(29-2)22(20)30-3)23(27)26-19-6-4-5-18(19)25-12-11-15-7-9-17(24)10-8-15/h7-10,13-14,18-19,25H,4-6,11-12H2,1-3H3,(H,26,27) |
| InChIKey | YGYTYRGPJANCOR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |