C22H28Cl2N2O3S — CID 22139546
N-[2-[3-(4-chlorophenyl)propylamino]cyclopentyl]-4-methylsulfonylbenzamide;hydrochloride (PubChem CID 22139546) has the molecular formula C22H28Cl2N2O3S and a molecular weight of 471.45 g/mol. Its IUPAC name is N-[2-[3-(4-chlorophenyl)propylamino]cyclopentyl]-4-methylsulfonylbenzamide;hydrochloride.
| Compound Name | N-[2-[3-(4-chlorophenyl)propylamino]cyclopentyl]-4-methylsulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 22139546 |
| Molecular Formula | C22H28Cl2N2O3S |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | N-[2-[3-(4-chlorophenyl)propylamino]cyclopentyl]-4-methylsulfonylbenzamide;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NC2CCCC2NCCCc2ccc(Cl)cc2)cc1.Cl |
| InChI | InChI=1S/C22H27ClN2O3S.ClH/c1-29(27,28)19-13-9-17(10-14-19)22(26)25-21-6-2-5-20(21)24-15-3-4-16-7-11-18(23)12-8-16;/h7-14,20-21,24H,2-6,15H2,1H3,(H,25,26);1H |
| InChIKey | HNRHVZUTPFFCAT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|