C21H25ClN2O3S — CID 10295688
N-[(1R,2R)-2-[2-(4-chlorophenyl)ethylamino]cyclopentyl]-4-methylsulfonylbenzamide (PubChem CID 10295688) has the molecular formula C21H25ClN2O3S and a molecular weight of 420.96 g/mol. Its IUPAC name is N-[(1R,2R)-2-[2-(4-chlorophenyl)ethylamino]cyclopentyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[(1R,2R)-2-[2-(4-chlorophenyl)ethylamino]cyclopentyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 10295688 |
| Molecular Formula | C21H25ClN2O3S |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-[(1R,2R)-2-[2-(4-chlorophenyl)ethylamino]cyclopentyl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N[C@@H]2CCC[C@H]2NCCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H25ClN2O3S/c1-28(26,27)18-11-7-16(8-12-18)21(25)24-20-4-2-3-19(20)23-14-13-15-5-9-17(22)10-6-15/h5-12,19-20,23H,2-4,13-14H2,1H3,(H,24,25)/t19-,20-/m1/s1 |
| InChIKey | IQMZGWIRONLTIX-WOJBJXKFSA-N |
| XLogP | 3.23 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |