C19H18O3 — CID 22145462
2-(4-propan-2-yloxyphenyl)naphthalene-1,6-diol (PubChem CID 22145462) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-(4-propan-2-yloxyphenyl)naphthalene-1,6-diol.
| Compound Name | 2-(4-propan-2-yloxyphenyl)naphthalene-1,6-diol |
|---|---|
| PubChem CID | 22145462 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-(4-propan-2-yloxyphenyl)naphthalene-1,6-diol |
| SMILES | CC(C)Oc1ccc(-c2ccc3cc(O)ccc3c2O)cc1 |
| InChI | InChI=1S/C19H18O3/c1-12(2)22-16-7-3-13(4-8-16)17-9-5-14-11-15(20)6-10-18(14)19(17)21/h3-12,20-21H,1-2H3 |
| InChIKey | WNDJVYDYZINKLN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |