C32H36O4Si — CID 18676038
[6-hydroxy-2-(4-hydroxyphenyl)naphthalen-1-yl]-[4-tri(propan-2-yl)silyloxyphenyl]methanone (PubChem CID 18676038) has the molecular formula C32H36O4Si and a molecular weight of 512.72 g/mol. Its IUPAC name is [6-hydroxy-2-(4-hydroxyphenyl)naphthalen-1-yl]-[4-tri(propan-2-yl)silyloxyphenyl]methanone.
| Compound Name | [6-hydroxy-2-(4-hydroxyphenyl)naphthalen-1-yl]-[4-tri(propan-2-yl)silyloxyphenyl]methanone |
|---|---|
| PubChem CID | 18676038 |
| Molecular Formula | C32H36O4Si |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | [6-hydroxy-2-(4-hydroxyphenyl)naphthalen-1-yl]-[4-tri(propan-2-yl)silyloxyphenyl]methanone |
| SMILES | CC(C)[Si](Oc1ccc(C(=O)c2c(-c3ccc(O)cc3)ccc3cc(O)ccc23)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H36O4Si/c1-20(2)37(21(3)4,22(5)6)36-28-15-9-24(10-16-28)32(35)31-29(23-7-12-26(33)13-8-23)17-11-25-19-27(34)14-18-30(25)31/h7-22,33-34H,1-6H3 |
| InChIKey | DEEHQCPWQCDILY-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|