C42H61NO4Si2 — CID 11664791
3-ethyl-N-(4-hydroxyphenyl)-6-tri(propan-2-yl)silyloxy-2-[4-tri(propan-2-yl)silyloxyphenyl]-1H-indene-1-carboxamide (PubChem CID 11664791) has the molecular formula C42H61NO4Si2 and a molecular weight of 700.13 g/mol. Its IUPAC name is 3-ethyl-N-(4-hydroxyphenyl)-6-tri(propan-2-yl)silyloxy-2-[4-tri(propan-2-yl)silyloxyphenyl]-1H-indene-1-carboxamide.
| Compound Name | 3-ethyl-N-(4-hydroxyphenyl)-6-tri(propan-2-yl)silyloxy-2-[4-tri(propan-2-yl)silyloxyphenyl]-1H-indene-1-carboxamide |
|---|---|
| PubChem CID | 11664791 |
| Molecular Formula | C42H61NO4Si2 |
| Molecular Weight | 700.13 g/mol |
| Exact Mass | 699.41 |
| IUPAC Name | 3-ethyl-N-(4-hydroxyphenyl)-6-tri(propan-2-yl)silyloxy-2-[4-tri(propan-2-yl)silyloxyphenyl]-1H-indene-1-carboxamide |
| SMILES | CCC1=C(c2ccc(O[Si](C(C)C)(C(C)C)C(C)C)cc2)C(C(=O)Nc2ccc(O)cc2)c2cc(O[Si](C(C)C)(C(C)C)C(C)C)ccc21 |
| InChI | InChI=1S/C42H61NO4Si2/c1-14-37-38-24-23-36(47-49(29(8)9,30(10)11)31(12)13)25-39(38)41(42(45)43-33-17-19-34(44)20-18-33)40(37)32-15-21-35(22-16-32)46-48(26(2)3,27(4)5)28(6)7/h15-31,41,44H,14H2,1-13H3,(H,43,45) |
| InChIKey | GMDUEXUYYRARQC-UHFFFAOYSA-N |
| XLogP | 12.56 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.13 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|