C18H21N3O5S — CID 22145732
4-cyclopentyloxy-5-methoxy-N-(2-sulfamoylphenyl)pyridine-2-carboxamide (PubChem CID 22145732) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 4-cyclopentyloxy-5-methoxy-N-(2-sulfamoylphenyl)pyridine-2-carboxamide.
| Compound Name | 4-cyclopentyloxy-5-methoxy-N-(2-sulfamoylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 22145732 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 4-cyclopentyloxy-5-methoxy-N-(2-sulfamoylphenyl)pyridine-2-carboxamide |
| SMILES | COc1cnc(C(=O)Nc2ccccc2S(N)(=O)=O)cc1OC1CCCC1 |
| InChI | InChI=1S/C18H21N3O5S/c1-25-16-11-20-14(10-15(16)26-12-6-2-3-7-12)18(22)21-13-8-4-5-9-17(13)27(19,23)24/h4-5,8-12H,2-3,6-7H2,1H3,(H,21,22)(H2,19,23,24) |
| InChIKey | PWZGMFQQJJPPKJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |