About tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium
tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium (PubChem CID 22146542) has the molecular formula C31H26BF12N
and a molecular weight of 651.34 g/mol. Its IUPAC name is tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium.
Molecular Properties
| Compound Name | tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium |
| PubChem CID | 22146542 |
| Molecular Formula | C31H26BF12N |
| Molecular Weight | 651.34 g/mol |
| Exact Mass | 651.20 |
| IUPAC Name | tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium |
| SMILES | C[NH+](C)C.FC(F)(F)c1ccc([B-](c2ccc(C(F)(F)F)cc2)(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H16BF12.C3H9N/c30-25(31,32)17-1-9-21(10-2-17)29(22-11-3-18(4-12-22)26(33,34)35,23-13-5-19(6-14-23)27(36,37)38)24-15-7-20(8-16-24)28(39,40)41;1-4(2)3/h1-16H;1-3H3/q-1;/p+1 |
| InChIKey | ULXWQWPIBXDGLQ-UHFFFAOYSA-O |
| XLogP | 5.90 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 651.34 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium?
The IUPAC name of tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium (CID 22146542) is tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium.
What is the SMILES notation for tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium?
The canonical SMILES for tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium is C[NH+](C)C.FC(F)(F)c1ccc([B-](c2ccc(C(F)(F)F)cc2)(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)cc1.
What is the InChIKey of tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium?
The InChIKey is ULXWQWPIBXDGLQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C28H16BF12.C3H9N/c30-25(31,32)17-1-9-21(10-2-17)29(22-11-3-18(4-12-22)26(33,34)35,23-13-5-19(6-14-23)27(36,37)38)24-15-7-20(8-16-24)28(39,40)41;1-4(2)3/h1-16H;1-3H3/q-1;/p+1.
What are the key properties of tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium?
tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium has a molecular weight of 651.34 g/mol, XLogP of 5.90, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis[4-(trifluoromethyl)phenyl]boranuide;trimethylazanium is sourced from PubChem (CID 22146542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).